C18H19FN4O4 — CID 171158274
2-(2,6-dioxopiperidin-3-yl)-5-fluoro-6-[(2S)-2-methylpiperazin-1-yl]isoindole-1,3-dione (PubChem CID 171158274) has the molecular formula C18H19FN4O4 and a molecular weight of 374.37 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-6-[(2S)-2-methylpiperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-6-[(2S)-2-methylpiperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 171158274 |
| Molecular Formula | C18H19FN4O4 |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-6-[(2S)-2-methylpiperazin-1-yl]isoindole-1,3-dione |
| SMILES | C[C@H]1CNCCN1c1cc2c(cc1F)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C18H19FN4O4/c1-9-8-20-4-5-22(9)14-7-11-10(6-12(14)19)17(26)23(18(11)27)13-2-3-15(24)21-16(13)25/h6-7,9,13,20H,2-5,8H2,1H3,(H,21,24,25)/t9-,13?/m0/s1 |
| InChIKey | CKENEHNIFNEZGX-LLTODGECSA-N |
| XLogP | 0.03 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|