C20H25N3O4 — CID 142367515
2-(2,6-dioxopiperidin-3-yl)-5-piperidin-4-ylisoindole-1,3-dione;ethane (PubChem CID 142367515) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-piperidin-4-ylisoindole-1,3-dione;ethane.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-piperidin-4-ylisoindole-1,3-dione;ethane |
|---|---|
| PubChem CID | 142367515 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-piperidin-4-ylisoindole-1,3-dione;ethane |
| SMILES | CC.O=C1CCC(N2C(=O)c3ccc(C4CCNCC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C18H19N3O4.C2H6/c22-15-4-3-14(16(23)20-15)21-17(24)12-2-1-11(9-13(12)18(21)25)10-5-7-19-8-6-10;1-2/h1-2,9-10,14,19H,3-8H2,(H,20,22,23);1-2H3 |
| InChIKey | ZVGCIWSXHVAMES-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|