C25H24F3N3O5S — CID 169310074
3-[6-[1-[(3,5-difluorophenyl)methylsulfonyl]piperidin-4-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169310074) has the molecular formula C25H24F3N3O5S and a molecular weight of 535.54 g/mol. Its IUPAC name is 3-[6-[1-[(3,5-difluorophenyl)methylsulfonyl]piperidin-4-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[1-[(3,5-difluorophenyl)methylsulfonyl]piperidin-4-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169310074 |
| Molecular Formula | C25H24F3N3O5S |
| Molecular Weight | 535.54 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | 3-[6-[1-[(3,5-difluorophenyl)methylsulfonyl]piperidin-4-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(C4CCN(S(=O)(=O)Cc5cc(F)cc(F)c5)CC4)c(F)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H24F3N3O5S/c26-17-7-14(8-18(27)10-17)13-37(35,36)30-5-3-15(4-6-30)19-9-16-12-31(25(34)20(16)11-21(19)28)22-1-2-23(32)29-24(22)33/h7-11,15,22H,1-6,12-13H2,(H,29,32,33) |
| InChIKey | QBYKYBXZROTHRA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.54 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|