C26H28FN3O5S — CID 169311653
3-[5-fluoro-7-[1-[(4-methylphenyl)methylsulfonyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169311653) has the molecular formula C26H28FN3O5S and a molecular weight of 513.59 g/mol. Its IUPAC name is 3-[5-fluoro-7-[1-[(4-methylphenyl)methylsulfonyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-fluoro-7-[1-[(4-methylphenyl)methylsulfonyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169311653 |
| Molecular Formula | C26H28FN3O5S |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | 3-[5-fluoro-7-[1-[(4-methylphenyl)methylsulfonyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Cc1ccc(CS(=O)(=O)N2CCC(c3cc(F)cc4c3CN(C3CCC(=O)NC3=O)C4=O)CC2)cc1 |
| InChI | InChI=1S/C26H28FN3O5S/c1-16-2-4-17(5-3-16)15-36(34,35)29-10-8-18(9-11-29)20-12-19(27)13-21-22(20)14-30(26(21)33)23-6-7-24(31)28-25(23)32/h2-5,12-13,18,23H,6-11,14-15H2,1H3,(H,28,31,32) |
| InChIKey | IZJGVZQPUKQIOD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|