C31H30FN3O4 — CID 169309753
3-[5-fluoro-3-oxo-7-[1-[(4-phenoxyphenyl)methyl]piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169309753) has the molecular formula C31H30FN3O4 and a molecular weight of 527.60 g/mol. Its IUPAC name is 3-[5-fluoro-3-oxo-7-[1-[(4-phenoxyphenyl)methyl]piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-fluoro-3-oxo-7-[1-[(4-phenoxyphenyl)methyl]piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169309753 |
| Molecular Formula | C31H30FN3O4 |
| Molecular Weight | 527.60 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | 3-[5-fluoro-3-oxo-7-[1-[(4-phenoxyphenyl)methyl]piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(cc(F)cc3C3CCN(Cc4ccc(Oc5ccccc5)cc4)CC3)C2=O)C(=O)N1 |
| InChI | InChI=1S/C31H30FN3O4/c32-22-16-25(27-19-35(31(38)26(27)17-22)28-10-11-29(36)33-30(28)37)21-12-14-34(15-13-21)18-20-6-8-24(9-7-20)39-23-4-2-1-3-5-23/h1-9,16-17,21,28H,10-15,18-19H2,(H,33,36,37) |
| InChIKey | BXZPXQPDXWGTNZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.60 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|