C32H28F2N4O4 — CID 169311584
3-[5-fluoro-7-[1-[[4-(2-fluoro-4-isocyanophenoxy)phenyl]methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169311584) has the molecular formula C32H28F2N4O4 and a molecular weight of 570.60 g/mol. Its IUPAC name is 3-[5-fluoro-7-[1-[[4-(2-fluoro-4-isocyanophenoxy)phenyl]methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-fluoro-7-[1-[[4-(2-fluoro-4-isocyanophenoxy)phenyl]methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169311584 |
| Molecular Formula | C32H28F2N4O4 |
| Molecular Weight | 570.60 g/mol |
| Exact Mass | 570.21 |
| IUPAC Name | 3-[5-fluoro-7-[1-[[4-(2-fluoro-4-isocyanophenoxy)phenyl]methyl]piperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | [C-]#[N+]c1ccc(Oc2ccc(CN3CCC(c4cc(F)cc5c4CN(C4CCC(=O)NC4=O)C5=O)CC3)cc2)c(F)c1 |
| InChI | InChI=1S/C32H28F2N4O4/c1-35-22-4-8-29(27(34)16-22)42-23-5-2-19(3-6-23)17-37-12-10-20(11-13-37)24-14-21(33)15-25-26(24)18-38(32(25)41)28-7-9-30(39)36-31(28)40/h2-6,8,14-16,20,28H,7,9-13,17-18H2,(H,36,39,40) |
| InChIKey | SYVSJCBNOLSTAQ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.60 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|