C32H31F2N3O4 — CID 67334359
3-[7-[[4-[[4-(2,4-difluorophenyl)piperidin-1-yl]methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 67334359) has the molecular formula C32H31F2N3O4 and a molecular weight of 559.61 g/mol. Its IUPAC name is 3-[7-[[4-[[4-(2,4-difluorophenyl)piperidin-1-yl]methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[4-[[4-(2,4-difluorophenyl)piperidin-1-yl]methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 67334359 |
| Molecular Formula | C32H31F2N3O4 |
| Molecular Weight | 559.61 g/mol |
| Exact Mass | 559.23 |
| IUPAC Name | 3-[7-[[4-[[4-(2,4-difluorophenyl)piperidin-1-yl]methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(OCc4ccc(CN5CCC(c6ccc(F)cc6F)CC5)cc4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C32H31F2N3O4/c33-23-8-9-24(27(34)16-23)22-12-14-36(15-13-22)17-20-4-6-21(7-5-20)19-41-29-3-1-2-25-26(29)18-37(32(25)40)28-10-11-30(38)35-31(28)39/h1-9,16,22,28H,10-15,17-19H2,(H,35,38,39) |
| InChIKey | PBLKZESKAFIJTA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.61 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|