C24H23F2N3O5S — CID 169310584
3-[5-fluoro-7-[1-(3-fluorophenyl)sulfonylpiperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169310584) has the molecular formula C24H23F2N3O5S and a molecular weight of 503.53 g/mol. Its IUPAC name is 3-[5-fluoro-7-[1-(3-fluorophenyl)sulfonylpiperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-fluoro-7-[1-(3-fluorophenyl)sulfonylpiperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169310584 |
| Molecular Formula | C24H23F2N3O5S |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | 3-[5-fluoro-7-[1-(3-fluorophenyl)sulfonylpiperidin-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(cc(F)cc3C3CCN(S(=O)(=O)c4cccc(F)c4)CC3)C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H23F2N3O5S/c25-15-2-1-3-17(10-15)35(33,34)28-8-6-14(7-9-28)18-11-16(26)12-19-20(18)13-29(24(19)32)21-4-5-22(30)27-23(21)31/h1-3,10-12,14,21H,4-9,13H2,(H,27,30,31) |
| InChIKey | YEFMIQGXQWNRJY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|