C27H24FN5O4 — CID 169310036
3-[5-fluoro-3-oxo-7-[1-(quinoxaline-5-carbonyl)piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169310036) has the molecular formula C27H24FN5O4 and a molecular weight of 501.52 g/mol. Its IUPAC name is 3-[5-fluoro-3-oxo-7-[1-(quinoxaline-5-carbonyl)piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-fluoro-3-oxo-7-[1-(quinoxaline-5-carbonyl)piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169310036 |
| Molecular Formula | C27H24FN5O4 |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | 3-[5-fluoro-3-oxo-7-[1-(quinoxaline-5-carbonyl)piperidin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(cc(F)cc3C3CCN(C(=O)c4cccc5nccnc45)CC3)C2=O)C(=O)N1 |
| InChI | InChI=1S/C27H24FN5O4/c28-16-12-18(20-14-33(27(37)19(20)13-16)22-4-5-23(34)31-25(22)35)15-6-10-32(11-7-15)26(36)17-2-1-3-21-24(17)30-9-8-29-21/h1-3,8-9,12-13,15,22H,4-7,10-11,14H2,(H,31,34,35) |
| InChIKey | AFOXAHPJJYZTAN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|