C26H28FN5O4 — CID 169310720
3-[7-[4-[2-(dimethylamino)benzoyl]piperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169310720) has the molecular formula C26H28FN5O4 and a molecular weight of 493.54 g/mol. Its IUPAC name is 3-[7-[4-[2-(dimethylamino)benzoyl]piperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[4-[2-(dimethylamino)benzoyl]piperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169310720 |
| Molecular Formula | C26H28FN5O4 |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 3-[7-[4-[2-(dimethylamino)benzoyl]piperazin-1-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CN(C)c1ccccc1C(=O)N1CCN(c2cc(F)cc3c2CN(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C26H28FN5O4/c1-29(2)20-6-4-3-5-17(20)25(35)31-11-9-30(10-12-31)22-14-16(27)13-18-19(22)15-32(26(18)36)21-7-8-23(33)28-24(21)34/h3-6,13-14,21H,7-12,15H2,1-2H3,(H,28,33,34) |
| InChIKey | GJQZCHNNQXMRBJ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 93.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|