C27H26FN5O4 — CID 169310294
3-[5-fluoro-7-[4-(1-methylindole-5-carbonyl)piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169310294) has the molecular formula C27H26FN5O4 and a molecular weight of 503.53 g/mol. Its IUPAC name is 3-[5-fluoro-7-[4-(1-methylindole-5-carbonyl)piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-fluoro-7-[4-(1-methylindole-5-carbonyl)piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169310294 |
| Molecular Formula | C27H26FN5O4 |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | 3-[5-fluoro-7-[4-(1-methylindole-5-carbonyl)piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Cn1ccc2cc(C(=O)N3CCN(c4cc(F)cc5c4CN(C4CCC(=O)NC4=O)C5=O)CC3)ccc21 |
| InChI | InChI=1S/C27H26FN5O4/c1-30-7-6-16-12-17(2-3-21(16)30)26(36)32-10-8-31(9-11-32)23-14-18(28)13-19-20(23)15-33(27(19)37)22-4-5-24(34)29-25(22)35/h2-3,6-7,12-14,22H,4-5,8-11,15H2,1H3,(H,29,34,35) |
| InChIKey | JEXCHKDVIQCYSA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 94.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|