C24H22F4N4O6S — CID 169309599
3-[5-fluoro-3-oxo-7-[4-[2-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169309599) has the molecular formula C24H22F4N4O6S and a molecular weight of 570.52 g/mol. Its IUPAC name is 3-[5-fluoro-3-oxo-7-[4-[2-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-fluoro-3-oxo-7-[4-[2-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169309599 |
| Molecular Formula | C24H22F4N4O6S |
| Molecular Weight | 570.52 g/mol |
| Exact Mass | 570.12 |
| IUPAC Name | 3-[5-fluoro-3-oxo-7-[4-[2-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(cc(F)cc3N3CCN(S(=O)(=O)c4ccccc4OC(F)(F)F)CC3)C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H22F4N4O6S/c25-14-11-15-16(13-32(23(15)35)17-5-6-21(33)29-22(17)34)18(12-14)30-7-9-31(10-8-30)39(36,37)20-4-2-1-3-19(20)38-24(26,27)28/h1-4,11-12,17H,5-10,13H2,(H,29,33,34) |
| InChIKey | SCNOVFSDHQUUBS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.52 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|