C25H23FN4O5S2 — CID 169309822
3-[6-[1-(1,3-benzothiazol-6-ylsulfonyl)piperidin-4-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169309822) has the molecular formula C25H23FN4O5S2 and a molecular weight of 542.61 g/mol. Its IUPAC name is 3-[6-[1-(1,3-benzothiazol-6-ylsulfonyl)piperidin-4-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[1-(1,3-benzothiazol-6-ylsulfonyl)piperidin-4-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169309822 |
| Molecular Formula | C25H23FN4O5S2 |
| Molecular Weight | 542.61 g/mol |
| Exact Mass | 542.11 |
| IUPAC Name | 3-[6-[1-(1,3-benzothiazol-6-ylsulfonyl)piperidin-4-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(C4CCN(S(=O)(=O)c5ccc6ncsc6c5)CC4)c(F)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H23FN4O5S2/c26-19-11-18-15(12-30(25(18)33)21-3-4-23(31)28-24(21)32)9-17(19)14-5-7-29(8-6-14)37(34,35)16-1-2-20-22(10-16)36-13-27-20/h1-2,9-11,13-14,21H,3-8,12H2,(H,28,31,32) |
| InChIKey | GGDKQLHZYAQDEE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.61 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|