C30H31FN4O5S — CID 169311154
3-[6-[1-[6-(dimethylamino)naphthalen-2-yl]sulfonylpiperidin-4-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169311154) has the molecular formula C30H31FN4O5S and a molecular weight of 578.67 g/mol. Its IUPAC name is 3-[6-[1-[6-(dimethylamino)naphthalen-2-yl]sulfonylpiperidin-4-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[1-[6-(dimethylamino)naphthalen-2-yl]sulfonylpiperidin-4-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169311154 |
| Molecular Formula | C30H31FN4O5S |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 578.20 |
| IUPAC Name | 3-[6-[1-[6-(dimethylamino)naphthalen-2-yl]sulfonylpiperidin-4-yl]-5-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CN(C)c1ccc2cc(S(=O)(=O)N3CCC(c4cc5c(cc4F)C(=O)N(C4CCC(=O)NC4=O)C5)CC3)ccc2c1 |
| InChI | InChI=1S/C30H31FN4O5S/c1-33(2)22-5-3-20-14-23(6-4-19(20)13-22)41(39,40)34-11-9-18(10-12-34)24-15-21-17-35(30(38)25(21)16-26(24)31)27-7-8-28(36)32-29(27)37/h3-6,13-16,18,27H,7-12,17H2,1-2H3,(H,32,36,37) |
| InChIKey | ULASIPIUSGRLCY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|