C25H24FN5O3 — CID 169311516
2-[[4-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-5-yl]piperidin-1-yl]methyl]pyridine-4-carbonitrile (PubChem CID 169311516) has the molecular formula C25H24FN5O3 and a molecular weight of 461.50 g/mol. Its IUPAC name is 2-[[4-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-5-yl]piperidin-1-yl]methyl]pyridine-4-carbonitrile.
| Compound Name | 2-[[4-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-5-yl]piperidin-1-yl]methyl]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 169311516 |
| Molecular Formula | C25H24FN5O3 |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 2-[[4-[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-5-yl]piperidin-1-yl]methyl]pyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(CN2CCC(c3cc4c(cc3F)C(=O)N(C3CCC(=O)NC3=O)C4)CC2)c1 |
| InChI | InChI=1S/C25H24FN5O3/c26-21-11-20-17(13-31(25(20)34)22-1-2-23(32)29-24(22)33)10-19(21)16-4-7-30(8-5-16)14-18-9-15(12-27)3-6-28-18/h3,6,9-11,16,22H,1-2,4-5,7-8,13-14H2,(H,29,32,33) |
| InChIKey | LWNAKWZPZZNETM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 106.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|