C23H21N3O7S — CID 67023258
2-(2,6-dioxopiperidin-3-yl)-N-(4-ethylsulfonylbenzoyl)-3-oxo-1H-isoindole-5-carboxamide (PubChem CID 67023258) has the molecular formula C23H21N3O7S and a molecular weight of 483.50 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-N-(4-ethylsulfonylbenzoyl)-3-oxo-1H-isoindole-5-carboxamide.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-N-(4-ethylsulfonylbenzoyl)-3-oxo-1H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 67023258 |
| Molecular Formula | C23H21N3O7S |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-N-(4-ethylsulfonylbenzoyl)-3-oxo-1H-isoindole-5-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(C(=O)NC(=O)c2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3)cc1 |
| InChI | InChI=1S/C23H21N3O7S/c1-2-34(32,33)16-7-5-13(6-8-16)20(28)25-21(29)14-3-4-15-12-26(23(31)17(15)11-14)18-9-10-19(27)24-22(18)30/h3-8,11,18H,2,9-10,12H2,1H3,(H,24,27,30)(H,25,28,29) |
| InChIKey | PHBBOPSZOLBZOQ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|