C21H23N3O6 — CID 166426013
1-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carbonyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 166426013) has the molecular formula C21H23N3O6 and a molecular weight of 413.43 g/mol. Its IUPAC name is 1-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carbonyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carbonyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 166426013 |
| Molecular Formula | C21H23N3O6 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 1-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carbonyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | O=C1CCC(N2Cc3ccc(C(=O)NC4(C(=O)O)CCCCC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H23N3O6/c25-16-7-6-15(18(27)22-16)24-11-13-5-4-12(10-14(13)19(24)28)17(26)23-21(20(29)30)8-2-1-3-9-21/h4-5,10,15H,1-3,6-9,11H2,(H,23,26)(H,29,30)(H,22,25,27) |
| InChIKey | KCLKYBVGFLRYGB-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|