C26H27N3O4 — CID 166409616
3-[3-oxo-5-(2-phenylazepane-1-carbonyl)-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 166409616) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is 3-[3-oxo-5-(2-phenylazepane-1-carbonyl)-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-5-(2-phenylazepane-1-carbonyl)-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166409616 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 3-[3-oxo-5-(2-phenylazepane-1-carbonyl)-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3ccc(C(=O)N4CCCCCC4c4ccccc4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H27N3O4/c30-23-13-12-22(24(31)27-23)29-16-19-11-10-18(15-20(19)26(29)33)25(32)28-14-6-2-5-9-21(28)17-7-3-1-4-8-17/h1,3-4,7-8,10-11,15,21-22H,2,5-6,9,12-14,16H2,(H,27,30,31) |
| InChIKey | DACFCYMYLCAMIW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|