C20H21N3O6 — CID 166426031
(2R)-1-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carbonyl]piperidine-2-carboxylic acid (PubChem CID 166426031) has the molecular formula C20H21N3O6 and a molecular weight of 399.40 g/mol. Its IUPAC name is (2R)-1-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carbonyl]piperidine-2-carboxylic acid.
| Compound Name | (2R)-1-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carbonyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 166426031 |
| Molecular Formula | C20H21N3O6 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | (2R)-1-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carbonyl]piperidine-2-carboxylic acid |
| SMILES | O=C1CCC(N2Cc3ccc(C(=O)N4CCCC[C@@H]4C(=O)O)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H21N3O6/c24-16-7-6-14(17(25)21-16)23-10-12-5-4-11(9-13(12)19(23)27)18(26)22-8-2-1-3-15(22)20(28)29/h4-5,9,14-15H,1-3,6-8,10H2,(H,28,29)(H,21,24,25)/t14?,15-/m1/s1 |
| InChIKey | WWCCOVYRUSSBEV-YSSOQSIOSA-N |
| XLogP | 0.53 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|