C30H34N4O6 — CID 156512274
3-[6-[[(2R)-1-(4-morpholin-4-ylbenzoyl)piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 156512274) has the molecular formula C30H34N4O6 and a molecular weight of 546.62 g/mol. Its IUPAC name is 3-[6-[[(2R)-1-(4-morpholin-4-ylbenzoyl)piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[(2R)-1-(4-morpholin-4-ylbenzoyl)piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 156512274 |
| Molecular Formula | C30H34N4O6 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | 3-[6-[[(2R)-1-(4-morpholin-4-ylbenzoyl)piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(OC[C@H]4CCCCN4C(=O)c4ccc(N5CCOCC5)cc4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H34N4O6/c35-27-11-10-26(28(36)31-27)34-18-21-17-24(8-9-25(21)30(34)38)40-19-23-3-1-2-12-33(23)29(37)20-4-6-22(7-5-20)32-13-15-39-16-14-32/h4-9,17,23,26H,1-3,10-16,18-19H2,(H,31,35,36)/t23-,26?/m1/s1 |
| InChIKey | YQLIAGCDDMFXSR-GEPVFLLWSA-N |
| XLogP | 2.36 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|