C31H37N3O5 — CID 156512029
3-[3-oxo-6-[[(2R)-1-(4-pentylbenzoyl)piperidin-2-yl]methoxy]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 156512029) has the molecular formula C31H37N3O5 and a molecular weight of 531.65 g/mol. Its IUPAC name is 3-[3-oxo-6-[[(2R)-1-(4-pentylbenzoyl)piperidin-2-yl]methoxy]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[[(2R)-1-(4-pentylbenzoyl)piperidin-2-yl]methoxy]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 156512029 |
| Molecular Formula | C31H37N3O5 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | 3-[3-oxo-6-[[(2R)-1-(4-pentylbenzoyl)piperidin-2-yl]methoxy]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CCCCCc1ccc(C(=O)N2CCCC[C@@H]2COc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C31H37N3O5/c1-2-3-4-7-21-9-11-22(12-10-21)30(37)33-17-6-5-8-24(33)20-39-25-13-14-26-23(18-25)19-34(31(26)38)27-15-16-28(35)32-29(27)36/h9-14,18,24,27H,2-8,15-17,19-20H2,1H3,(H,32,35,36)/t24-,27?/m1/s1 |
| InChIKey | GBISCWSFISIGEQ-DXDQHDRFSA-N |
| XLogP | 4.25 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|