C24H29N3O6 — CID 156512014
3-[3-oxo-6-[[(2R)-1-[(3S)-oxolane-3-carbonyl]piperidin-2-yl]methoxy]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 156512014) has the molecular formula C24H29N3O6 and a molecular weight of 455.51 g/mol. Its IUPAC name is 3-[3-oxo-6-[[(2R)-1-[(3S)-oxolane-3-carbonyl]piperidin-2-yl]methoxy]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[[(2R)-1-[(3S)-oxolane-3-carbonyl]piperidin-2-yl]methoxy]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 156512014 |
| Molecular Formula | C24H29N3O6 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 3-[3-oxo-6-[[(2R)-1-[(3S)-oxolane-3-carbonyl]piperidin-2-yl]methoxy]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(OC[C@H]4CCCCN4C(=O)[C@H]4CCOC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H29N3O6/c28-21-7-6-20(22(29)25-21)27-12-16-11-18(4-5-19(16)24(27)31)33-14-17-3-1-2-9-26(17)23(30)15-8-10-32-13-15/h4-5,11,15,17,20H,1-3,6-10,12-14H2,(H,25,28,29)/t15-,17+,20?/m0/s1 |
| InChIKey | QJQFAKBCKIBBFF-DAPIJDQBSA-N |
| XLogP | 1.24 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|