C32H38N4O5 — CID 156512031
3-[6-[[(2R)-1-(1-benzylpiperidine-3-carbonyl)piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 156512031) has the molecular formula C32H38N4O5 and a molecular weight of 558.68 g/mol. Its IUPAC name is 3-[6-[[(2R)-1-(1-benzylpiperidine-3-carbonyl)piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[(2R)-1-(1-benzylpiperidine-3-carbonyl)piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 156512031 |
| Molecular Formula | C32H38N4O5 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | 3-[6-[[(2R)-1-(1-benzylpiperidine-3-carbonyl)piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(OC[C@H]4CCCCN4C(=O)C4CCCN(Cc5ccccc5)C4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C32H38N4O5/c37-29-14-13-28(30(38)33-29)36-20-24-17-26(11-12-27(24)32(36)40)41-21-25-10-4-5-16-35(25)31(39)23-9-6-15-34(19-23)18-22-7-2-1-3-8-22/h1-3,7-8,11-12,17,23,25,28H,4-6,9-10,13-16,18-21H2,(H,33,37,38)/t23?,25-,28?/m1/s1 |
| InChIKey | LIEDCMUVGFCJFB-XSGAYFKKSA-N |
| XLogP | 3.12 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|