C30H31N5O5 — CID 156501034
3-[6-[[(2S)-1-(4-methyl-3-phenyl-1H-pyrazole-5-carbonyl)piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 156501034) has the molecular formula C30H31N5O5 and a molecular weight of 541.61 g/mol. Its IUPAC name is 3-[6-[[(2S)-1-(4-methyl-3-phenyl-1H-pyrazole-5-carbonyl)piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[(2S)-1-(4-methyl-3-phenyl-1H-pyrazole-5-carbonyl)piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 156501034 |
| Molecular Formula | C30H31N5O5 |
| Molecular Weight | 541.61 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | 3-[6-[[(2S)-1-(4-methyl-3-phenyl-1H-pyrazole-5-carbonyl)piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Cc1c(-c2ccccc2)n[nH]c1C(=O)N1CCCC[C@H]1COc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C30H31N5O5/c1-18-26(19-7-3-2-4-8-19)32-33-27(18)30(39)34-14-6-5-9-21(34)17-40-22-10-11-23-20(15-22)16-35(29(23)38)24-12-13-25(36)31-28(24)37/h2-4,7-8,10-11,15,21,24H,5-6,9,12-14,16-17H2,1H3,(H,32,33)(H,31,36,37)/t21-,24?/m0/s1 |
| InChIKey | XAJFESAKNSZVNY-XEGCMXMBSA-N |
| XLogP | 3.22 |
| TPSA | 124.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.61 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|