C31H37N4O5+ — CID 156792142
[2-benzyl-3-[(2S)-2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxymethyl]piperidin-1-yl]-3-oxopropylidene]-dimethylazanium (PubChem CID 156792142) has the molecular formula C31H37N4O5+ and a molecular weight of 545.66 g/mol. Its IUPAC name is [2-benzyl-3-[(2S)-2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxymethyl]piperidin-1-yl]-3-oxopropylidene]-dimethylazanium.
| Compound Name | [2-benzyl-3-[(2S)-2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxymethyl]piperidin-1-yl]-3-oxopropylidene]-dimethylazanium |
|---|---|
| PubChem CID | 156792142 |
| Molecular Formula | C31H37N4O5+ |
| Molecular Weight | 545.66 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | [2-benzyl-3-[(2S)-2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxymethyl]piperidin-1-yl]-3-oxopropylidene]-dimethylazanium |
| SMILES | C[N+](C)=CC(Cc1ccccc1)C(=O)N1CCCC[C@H]1COc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C31H36N4O5/c1-33(2)18-23(16-21-8-4-3-5-9-21)30(38)34-15-7-6-10-24(34)20-40-25-11-12-26-22(17-25)19-35(31(26)39)27-13-14-28(36)32-29(27)37/h3-5,8-9,11-12,17-18,23-24,27H,6-7,10,13-16,19-20H2,1-2H3/p+1/t23?,24-,27?/m0/s1 |
| InChIKey | ORWKJNKLHPVZMZ-IDZWTHILSA-O |
| XLogP | 2.41 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.66 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|