C26H28N4O6 — CID 156512127
3-[6-[[(2R)-1-(1-methyl-2-oxopyridine-4-carbonyl)piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 156512127) has the molecular formula C26H28N4O6 and a molecular weight of 492.53 g/mol. Its IUPAC name is 3-[6-[[(2R)-1-(1-methyl-2-oxopyridine-4-carbonyl)piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[(2R)-1-(1-methyl-2-oxopyridine-4-carbonyl)piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 156512127 |
| Molecular Formula | C26H28N4O6 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 3-[6-[[(2R)-1-(1-methyl-2-oxopyridine-4-carbonyl)piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Cn1ccc(C(=O)N2CCCC[C@@H]2COc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)cc1=O |
| InChI | InChI=1S/C26H28N4O6/c1-28-11-9-16(13-23(28)32)25(34)29-10-3-2-4-18(29)15-36-19-5-6-20-17(12-19)14-30(26(20)35)21-7-8-22(31)27-24(21)33/h5-6,9,11-13,18,21H,2-4,7-8,10,14-15H2,1H3,(H,27,31,33)/t18-,21?/m1/s1 |
| InChIKey | FRJKRCZPCVBZHL-ITUIMRKVSA-N |
| XLogP | 1.22 |
| TPSA | 118.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|