C26H30N4O6 — CID 156501049
3-[3-oxo-6-[[1-(5-propan-2-yl-1,2-oxazole-3-carbonyl)piperidin-2-yl]methoxy]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 156501049) has the molecular formula C26H30N4O6 and a molecular weight of 494.55 g/mol. Its IUPAC name is 3-[3-oxo-6-[[1-(5-propan-2-yl-1,2-oxazole-3-carbonyl)piperidin-2-yl]methoxy]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[[1-(5-propan-2-yl-1,2-oxazole-3-carbonyl)piperidin-2-yl]methoxy]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 156501049 |
| Molecular Formula | C26H30N4O6 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 3-[3-oxo-6-[[1-(5-propan-2-yl-1,2-oxazole-3-carbonyl)piperidin-2-yl]methoxy]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC(C)c1cc(C(=O)N2CCCCC2COc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)no1 |
| InChI | InChI=1S/C26H30N4O6/c1-15(2)22-12-20(28-36-22)26(34)29-10-4-3-5-17(29)14-35-18-6-7-19-16(11-18)13-30(25(19)33)21-8-9-23(31)27-24(21)32/h6-7,11-12,15,17,21H,3-5,8-10,13-14H2,1-2H3,(H,27,31,32) |
| InChIKey | FRANGHYFDPEXLH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|