C34H35N3O7 — CID 156500654
3-[6-[[1-(4-methoxy-3-phenylmethoxybenzoyl)piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 156500654) has the molecular formula C34H35N3O7 and a molecular weight of 597.67 g/mol. Its IUPAC name is 3-[6-[[1-(4-methoxy-3-phenylmethoxybenzoyl)piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[1-(4-methoxy-3-phenylmethoxybenzoyl)piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 156500654 |
| Molecular Formula | C34H35N3O7 |
| Molecular Weight | 597.67 g/mol |
| Exact Mass | 597.25 |
| IUPAC Name | 3-[6-[[1-(4-methoxy-3-phenylmethoxybenzoyl)piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | COc1ccc(C(=O)N2CCCCC2COc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)cc1OCc1ccccc1 |
| InChI | InChI=1S/C34H35N3O7/c1-42-29-14-10-23(18-30(29)44-20-22-7-3-2-4-8-22)33(40)36-16-6-5-9-25(36)21-43-26-11-12-27-24(17-26)19-37(34(27)41)28-13-15-31(38)35-32(28)39/h2-4,7-8,10-12,14,17-18,25,28H,5-6,9,13,15-16,19-21H2,1H3,(H,35,38,39) |
| InChIKey | BWEHBYOFSZDODI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.67 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|