C30H37N5O4 — CID 156500481
3-[3-oxo-6-[[1-[(4-piperazin-1-ylphenyl)methyl]piperidin-2-yl]methoxy]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 156500481) has the molecular formula C30H37N5O4 and a molecular weight of 531.66 g/mol. Its IUPAC name is 3-[3-oxo-6-[[1-[(4-piperazin-1-ylphenyl)methyl]piperidin-2-yl]methoxy]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[[1-[(4-piperazin-1-ylphenyl)methyl]piperidin-2-yl]methoxy]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 156500481 |
| Molecular Formula | C30H37N5O4 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | 3-[3-oxo-6-[[1-[(4-piperazin-1-ylphenyl)methyl]piperidin-2-yl]methoxy]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(OCC4CCCCN4Cc4ccc(N5CCNCC5)cc4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H37N5O4/c36-28-11-10-27(29(37)32-28)35-19-22-17-25(8-9-26(22)30(35)38)39-20-24-3-1-2-14-34(24)18-21-4-6-23(7-5-21)33-15-12-31-13-16-33/h4-9,17,24,27,31H,1-3,10-16,18-20H2,(H,32,36,37) |
| InChIKey | PTRJPMOSPRPXHA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|