C34H45N5O4 — CID 156500660
3-[6-[[(2R)-1-[[4-(4-tert-butylpiperazin-1-yl)phenyl]methyl]piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 156500660) has the molecular formula C34H45N5O4 and a molecular weight of 587.77 g/mol. Its IUPAC name is 3-[6-[[(2R)-1-[[4-(4-tert-butylpiperazin-1-yl)phenyl]methyl]piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[(2R)-1-[[4-(4-tert-butylpiperazin-1-yl)phenyl]methyl]piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 156500660 |
| Molecular Formula | C34H45N5O4 |
| Molecular Weight | 587.77 g/mol |
| Exact Mass | 587.35 |
| IUPAC Name | 3-[6-[[(2R)-1-[[4-(4-tert-butylpiperazin-1-yl)phenyl]methyl]piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC(C)(C)N1CCN(c2ccc(CN3CCCC[C@@H]3COc3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)cc2)CC1 |
| InChI | InChI=1S/C34H45N5O4/c1-34(2,3)38-18-16-36(17-19-38)26-9-7-24(8-10-26)21-37-15-5-4-6-27(37)23-43-28-11-12-29-25(20-28)22-39(33(29)42)30-13-14-31(40)35-32(30)41/h7-12,20,27,30H,4-6,13-19,21-23H2,1-3H3,(H,35,40,41)/t27-,30?/m1/s1 |
| InChIKey | MEBCYFAZKJENMM-NHQUYOMTSA-N |
| XLogP | 3.80 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.77 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|