C29H35N5O5 — CID 156501119
3-[6-[[1-[(2-morpholin-4-yl-4-pyridinyl)methyl]piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 156501119) has the molecular formula C29H35N5O5 and a molecular weight of 533.63 g/mol. Its IUPAC name is 3-[6-[[1-[(2-morpholin-4-yl-4-pyridinyl)methyl]piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[1-[(2-morpholin-4-yl-4-pyridinyl)methyl]piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 156501119 |
| Molecular Formula | C29H35N5O5 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | 3-[6-[[1-[(2-morpholin-4-yl-4-pyridinyl)methyl]piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(OCC4CCCCN4Cc4ccnc(N5CCOCC5)c4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C29H35N5O5/c35-27-7-6-25(28(36)31-27)34-18-21-16-23(4-5-24(21)29(34)37)39-19-22-3-1-2-10-33(22)17-20-8-9-30-26(15-20)32-11-13-38-14-12-32/h4-5,8-9,15-16,22,25H,1-3,6-7,10-14,17-19H2,(H,31,35,36) |
| InChIKey | SOCYKQKRZGCGPV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|