C30H36N4O5 — CID 156511979
3-[6-[[(2R)-1-[(4-morpholin-4-ylphenyl)methyl]piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 156511979) has the molecular formula C30H36N4O5 and a molecular weight of 532.64 g/mol. Its IUPAC name is 3-[6-[[(2R)-1-[(4-morpholin-4-ylphenyl)methyl]piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[(2R)-1-[(4-morpholin-4-ylphenyl)methyl]piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 156511979 |
| Molecular Formula | C30H36N4O5 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | 3-[6-[[(2R)-1-[(4-morpholin-4-ylphenyl)methyl]piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(OC[C@H]4CCCCN4Cc4ccc(N5CCOCC5)cc4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H36N4O5/c35-28-11-10-27(29(36)31-28)34-19-22-17-25(8-9-26(22)30(34)37)39-20-24-3-1-2-12-33(24)18-21-4-6-23(7-5-21)32-13-15-38-16-14-32/h4-9,17,24,27H,1-3,10-16,18-20H2,(H,31,35,36)/t24-,27?/m1/s1 |
| InChIKey | VJFBGALUNONBAH-DXDQHDRFSA-N |
| XLogP | 2.72 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|