C25H30FN3O4 — CID 174201274
3-[6-[[1-[(3-fluoro-2-methylcyclobuten-1-yl)methyl]piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 174201274) has the molecular formula C25H30FN3O4 and a molecular weight of 455.53 g/mol. Its IUPAC name is 3-[6-[[1-[(3-fluoro-2-methylcyclobuten-1-yl)methyl]piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[1-[(3-fluoro-2-methylcyclobuten-1-yl)methyl]piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 174201274 |
| Molecular Formula | C25H30FN3O4 |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 3-[6-[[1-[(3-fluoro-2-methylcyclobuten-1-yl)methyl]piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC1=C(CN2CCCCC2COc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)CC1F |
| InChI | InChI=1S/C25H30FN3O4/c1-15-16(11-21(15)26)12-28-9-3-2-4-18(28)14-33-19-5-6-20-17(10-19)13-29(25(20)32)22-7-8-23(30)27-24(22)31/h5-6,10,18,21-22H,2-4,7-9,11-14H2,1H3,(H,27,30,31) |
| InChIKey | BDSBCIRYLCCSAM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|