C21H23N3O6 — CID 166426025
2-[1-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carbonyl]amino]cyclopentyl]acetic acid (PubChem CID 166426025) has the molecular formula C21H23N3O6 and a molecular weight of 413.43 g/mol. Its IUPAC name is 2-[1-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carbonyl]amino]cyclopentyl]acetic acid.
| Compound Name | 2-[1-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carbonyl]amino]cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 166426025 |
| Molecular Formula | C21H23N3O6 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 2-[1-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carbonyl]amino]cyclopentyl]acetic acid |
| SMILES | O=C(O)CC1(NC(=O)c2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3)CCCC1 |
| InChI | InChI=1S/C21H23N3O6/c25-16-6-5-15(19(29)22-16)24-11-13-4-3-12(9-14(13)20(24)30)18(28)23-21(10-17(26)27)7-1-2-8-21/h3-4,9,15H,1-2,5-8,10-11H2,(H,23,28)(H,26,27)(H,22,25,29) |
| InChIKey | RTZVIHYBWDFLRF-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|