C20H23N3O6 — CID 166426015
4-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carbonyl]amino]-4-methylpentanoic acid (PubChem CID 166426015) has the molecular formula C20H23N3O6 and a molecular weight of 401.42 g/mol. Its IUPAC name is 4-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carbonyl]amino]-4-methylpentanoic acid.
| Compound Name | 4-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carbonyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 166426015 |
| Molecular Formula | C20H23N3O6 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 4-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carbonyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NC(=O)c1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2 |
| InChI | InChI=1S/C20H23N3O6/c1-20(2,8-7-16(25)26)22-17(27)11-3-4-12-10-23(19(29)13(12)9-11)14-5-6-15(24)21-18(14)28/h3-4,9,14H,5-8,10H2,1-2H3,(H,22,27)(H,25,26)(H,21,24,28) |
| InChIKey | GCZVMOTWSCCGAR-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|