C14H18N3O3+ — CID 155746155
methylazanium;3-(3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (PubChem CID 155746155) has the molecular formula C14H18N3O3+ and a molecular weight of 276.32 g/mol. Its IUPAC name is methylazanium;3-(3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione.
| Compound Name | methylazanium;3-(3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 155746155 |
| Molecular Formula | C14H18N3O3+ |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | methylazanium;3-(3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| SMILES | C[NH3+].O=C1CCC(N2Cc3ccccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C13H12N2O3.CH5N/c16-11-6-5-10(12(17)14-11)15-7-8-3-1-2-4-9(8)13(15)18;1-2/h1-4,10H,5-7H2,(H,14,16,17);2H2,1H3/p+1 |
| InChIKey | RYQHAOOLUATBHU-UHFFFAOYSA-O |
| XLogP | -0.69 |
| TPSA | 94.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|