C14H14N2O2 — CID 165027847
3-(3-methylidene-1H-isoindol-2-yl)piperidine-2,6-dione (PubChem CID 165027847) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 3-(3-methylidene-1H-isoindol-2-yl)piperidine-2,6-dione.
| Compound Name | 3-(3-methylidene-1H-isoindol-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 165027847 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 3-(3-methylidene-1H-isoindol-2-yl)piperidine-2,6-dione |
| SMILES | C=C1c2ccccc2CN1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C14H14N2O2/c1-9-11-5-3-2-4-10(11)8-16(9)12-6-7-13(17)15-14(12)18/h2-5,12H,1,6-8H2,(H,15,17,18) |
| InChIKey | ZMLCEMBXBPQVBF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|