C12H12N4O2 — CID 170177680
3-(4H-1,2,3-benzotriazin-3-yl)piperidine-2,6-dione (PubChem CID 170177680) has the molecular formula C12H12N4O2 and a molecular weight of 244.25 g/mol. Its IUPAC name is 3-(4H-1,2,3-benzotriazin-3-yl)piperidine-2,6-dione.
| Compound Name | 3-(4H-1,2,3-benzotriazin-3-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 170177680 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 3-(4H-1,2,3-benzotriazin-3-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3ccccc3N=N2)C(=O)N1 |
| InChI | InChI=1S/C12H12N4O2/c17-11-6-5-10(12(18)13-11)16-7-8-3-1-2-4-9(8)14-15-16/h1-4,10H,5-7H2,(H,13,17,18) |
| InChIKey | UVZAYDFLHHWUFI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|