C9H10N2O4 — CID 121493318
(3R)-3-(2,5-dioxopyrrolidin-1-yl)piperidine-2,6-dione (PubChem CID 121493318) has the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. Its IUPAC name is (3R)-3-(2,5-dioxopyrrolidin-1-yl)piperidine-2,6-dione.
| Compound Name | (3R)-3-(2,5-dioxopyrrolidin-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 121493318 |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | (3R)-3-(2,5-dioxopyrrolidin-1-yl)piperidine-2,6-dione |
| SMILES | O=C1CC[C@@H](N2C(=O)CCC2=O)C(=O)N1 |
| InChI | InChI=1S/C9H10N2O4/c12-6-2-1-5(9(15)10-6)11-7(13)3-4-8(11)14/h5H,1-4H2,(H,10,12,15)/t5-/m1/s1 |
| InChIKey | HHSYPPYKDPFHGB-RXMQYKEDSA-N |
| XLogP | -1.06 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|