C15H16N2O3S — CID 177161115
3-[6-[methyl(methylidene)-λ4-sulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 177161115) has the molecular formula C15H16N2O3S and a molecular weight of 304.37 g/mol. Its IUPAC name is 3-[6-[methyl(methylidene)-λ4-sulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[methyl(methylidene)-λ4-sulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177161115 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 3-[6-[methyl(methylidene)-λ4-sulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | C=S(C)c1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C15H16N2O3S/c1-21(2)10-3-4-11-9(7-10)8-17(15(11)20)12-5-6-13(18)16-14(12)19/h3-4,7,12H,1,5-6,8H2,2H3,(H,16,18,19) |
| InChIKey | SBTBNYHOEJUIEZ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|