C20H26N2O4 — CID 153391942
3-(6-cyclopentyloxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;ethane (PubChem CID 153391942) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is 3-(6-cyclopentyloxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;ethane.
| Compound Name | 3-(6-cyclopentyloxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;ethane |
|---|---|
| PubChem CID | 153391942 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 3-(6-cyclopentyloxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;ethane |
| SMILES | CC.O=C1CCC(N2Cc3cc(OC4CCCC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C18H20N2O4.C2H6/c21-16-8-7-15(17(22)19-16)20-10-11-9-13(5-6-14(11)18(20)23)24-12-3-1-2-4-12;1-2/h5-6,9,12,15H,1-4,7-8,10H2,(H,19,21,22);1-2H3 |
| InChIKey | YTMRVHTZEQBKQQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|