C18H21N3O4 — CID 134413864
3-(3-oxo-6-piperidin-4-yloxy-1H-isoindol-2-yl)piperidine-2,6-dione (PubChem CID 134413864) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is 3-(3-oxo-6-piperidin-4-yloxy-1H-isoindol-2-yl)piperidine-2,6-dione.
| Compound Name | 3-(3-oxo-6-piperidin-4-yloxy-1H-isoindol-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 134413864 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 3-(3-oxo-6-piperidin-4-yloxy-1H-isoindol-2-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(OC4CCNCC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C18H21N3O4/c22-16-4-3-15(17(23)20-16)21-10-11-9-13(1-2-14(11)18(21)24)25-12-5-7-19-8-6-12/h1-2,9,12,15,19H,3-8,10H2,(H,20,22,23) |
| InChIKey | PYCJTKYZWSAZPO-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|