C27H31N3O4 — CID 166468834
3-(6-cyclopentyloxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;3-phenylazetidine (PubChem CID 166468834) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is 3-(6-cyclopentyloxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;3-phenylazetidine.
| Compound Name | 3-(6-cyclopentyloxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;3-phenylazetidine |
|---|---|
| PubChem CID | 166468834 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 3-(6-cyclopentyloxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;3-phenylazetidine |
| SMILES | O=C1CCC(N2Cc3cc(OC4CCCC4)ccc3C2=O)C(=O)N1.c1ccc(C2CNC2)cc1 |
| InChI | InChI=1S/C18H20N2O4.C9H11N/c21-16-8-7-15(17(22)19-16)20-10-11-9-13(5-6-14(11)18(20)23)24-12-3-1-2-4-12;1-2-4-8(5-3-1)9-6-10-7-9/h5-6,9,12,15H,1-4,7-8,10H2,(H,19,21,22);1-5,9-10H,6-7H2 |
| InChIKey | SLIUOCPGYGSDSU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|