C29H33F2N3O5 — CID 166469240
3-(6-cyclohexyloxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;3-[4-(difluoromethoxy)phenyl]azetidine (PubChem CID 166469240) has the molecular formula C29H33F2N3O5 and a molecular weight of 541.60 g/mol. Its IUPAC name is 3-(6-cyclohexyloxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;3-[4-(difluoromethoxy)phenyl]azetidine.
| Compound Name | 3-(6-cyclohexyloxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;3-[4-(difluoromethoxy)phenyl]azetidine |
|---|---|
| PubChem CID | 166469240 |
| Molecular Formula | C29H33F2N3O5 |
| Molecular Weight | 541.60 g/mol |
| Exact Mass | 541.24 |
| IUPAC Name | 3-(6-cyclohexyloxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;3-[4-(difluoromethoxy)phenyl]azetidine |
| SMILES | FC(F)Oc1ccc(C2CNC2)cc1.O=C1CCC(N2Cc3cc(OC4CCCCC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C19H22N2O4.C10H11F2NO/c22-17-9-8-16(18(23)20-17)21-11-12-10-14(6-7-15(12)19(21)24)25-13-4-2-1-3-5-13;11-10(12)14-9-3-1-7(2-4-9)8-5-13-6-8/h6-7,10,13,16H,1-5,8-9,11H2,(H,20,22,23);1-4,8,10,13H,5-6H2 |
| InChIKey | AZSUSDMLQUJLBY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.60 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|