C29H31F2N3O5 — CID 167306987
3-[6-[(1R,2R)-2-[3-[4-(difluoromethoxy)phenyl]azetidin-1-yl]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167306987) has the molecular formula C29H31F2N3O5 and a molecular weight of 539.58 g/mol. Its IUPAC name is 3-[6-[(1R,2R)-2-[3-[4-(difluoromethoxy)phenyl]azetidin-1-yl]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(1R,2R)-2-[3-[4-(difluoromethoxy)phenyl]azetidin-1-yl]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167306987 |
| Molecular Formula | C29H31F2N3O5 |
| Molecular Weight | 539.58 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | 3-[6-[(1R,2R)-2-[3-[4-(difluoromethoxy)phenyl]azetidin-1-yl]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(O[C@@H]4CCCC[C@H]4N4CC(c5ccc(OC(F)F)cc5)C4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C29H31F2N3O5/c30-29(31)39-20-7-5-17(6-8-20)19-14-33(15-19)23-3-1-2-4-25(23)38-21-9-10-22-18(13-21)16-34(28(22)37)24-11-12-26(35)32-27(24)36/h5-10,13,19,23-25,29H,1-4,11-12,14-16H2,(H,32,35,36)/t23-,24?,25-/m1/s1 |
| InChIKey | YOTWLUXXGCNPBI-VSPQQOHGSA-N |
| XLogP | 3.84 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.58 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|