C28H30FN3O4 — CID 167307192
(3R)-3-[6-[(1S,2R)-2-[3-(4-fluorophenyl)azetidin-1-yl]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167307192) has the molecular formula C28H30FN3O4 and a molecular weight of 491.56 g/mol. Its IUPAC name is (3R)-3-[6-[(1S,2R)-2-[3-(4-fluorophenyl)azetidin-1-yl]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | (3R)-3-[6-[(1S,2R)-2-[3-(4-fluorophenyl)azetidin-1-yl]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167307192 |
| Molecular Formula | C28H30FN3O4 |
| Molecular Weight | 491.56 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | (3R)-3-[6-[(1S,2R)-2-[3-(4-fluorophenyl)azetidin-1-yl]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CC[C@@H](N2Cc3cc(O[C@H]4CCCC[C@H]4N4CC(c5ccc(F)cc5)C4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C28H30FN3O4/c29-20-7-5-17(6-8-20)19-14-31(15-19)23-3-1-2-4-25(23)36-21-9-10-22-18(13-21)16-32(28(22)35)24-11-12-26(33)30-27(24)34/h5-10,13,19,23-25H,1-4,11-12,14-16H2,(H,30,33,34)/t23-,24-,25+/m1/s1 |
| InChIKey | DVMNBFKJAKDJAH-SDHSZQHLSA-N |
| XLogP | 3.38 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.56 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|