C28H29F2N3O4 — CID 167306977
3-[6-[(1R,2R)-2-[3-(2,4-difluorophenyl)azetidin-1-yl]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167306977) has the molecular formula C28H29F2N3O4 and a molecular weight of 509.55 g/mol. Its IUPAC name is 3-[6-[(1R,2R)-2-[3-(2,4-difluorophenyl)azetidin-1-yl]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(1R,2R)-2-[3-(2,4-difluorophenyl)azetidin-1-yl]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167306977 |
| Molecular Formula | C28H29F2N3O4 |
| Molecular Weight | 509.55 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | 3-[6-[(1R,2R)-2-[3-(2,4-difluorophenyl)azetidin-1-yl]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(O[C@@H]4CCCC[C@H]4N4CC(c5ccc(F)cc5F)C4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C28H29F2N3O4/c29-18-5-7-20(22(30)12-18)17-13-32(14-17)23-3-1-2-4-25(23)37-19-6-8-21-16(11-19)15-33(28(21)36)24-9-10-26(34)31-27(24)35/h5-8,11-12,17,23-25H,1-4,9-10,13-15H2,(H,31,34,35)/t23-,24?,25-/m1/s1 |
| InChIKey | XVGVCDNDEKXDOT-VSPQQOHGSA-N |
| XLogP | 3.52 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.55 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|