C27H29FN4O4 — CID 167303175
(3R)-3-[6-[(1R,2S)-2-[3-(3-fluoro-4-pyridinyl)azetidin-1-yl]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167303175) has the molecular formula C27H29FN4O4 and a molecular weight of 492.55 g/mol. Its IUPAC name is (3R)-3-[6-[(1R,2S)-2-[3-(3-fluoro-4-pyridinyl)azetidin-1-yl]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | (3R)-3-[6-[(1R,2S)-2-[3-(3-fluoro-4-pyridinyl)azetidin-1-yl]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167303175 |
| Molecular Formula | C27H29FN4O4 |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | (3R)-3-[6-[(1R,2S)-2-[3-(3-fluoro-4-pyridinyl)azetidin-1-yl]cyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CC[C@@H](N2Cc3cc(O[C@@H]4CCCC[C@@H]4N4CC(c5ccncc5F)C4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C27H29FN4O4/c28-21-12-29-10-9-19(21)17-13-31(14-17)22-3-1-2-4-24(22)36-18-5-6-20-16(11-18)15-32(27(20)35)23-7-8-25(33)30-26(23)34/h5-6,9-12,17,22-24H,1-4,7-8,13-15H2,(H,30,33,34)/t22-,23+,24+/m0/s1 |
| InChIKey | BNXRVTJVUKUWEW-RBZQAINGSA-N |
| XLogP | 2.77 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|