C25H26N4O4 — CID 151612733
3-[6-[(1S,2R)-2-(1,3-dihydropyrrolo[3,4-c]pyridin-2-yl)cyclopentyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 151612733) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is 3-[6-[(1S,2R)-2-(1,3-dihydropyrrolo[3,4-c]pyridin-2-yl)cyclopentyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(1S,2R)-2-(1,3-dihydropyrrolo[3,4-c]pyridin-2-yl)cyclopentyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 151612733 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 3-[6-[(1S,2R)-2-(1,3-dihydropyrrolo[3,4-c]pyridin-2-yl)cyclopentyl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(O[C@H]4CCC[C@H]4N4Cc5ccncc5C4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H26N4O4/c30-23-7-6-21(24(31)27-23)29-14-16-10-18(4-5-19(16)25(29)32)33-22-3-1-2-20(22)28-12-15-8-9-26-11-17(15)13-28/h4-5,8-11,20-22H,1-3,6-7,12-14H2,(H,27,30,31)/t20-,21?,22+/m1/s1 |
| InChIKey | QMVUVAYAVKVHJI-QFMSAKRMSA-N |
| XLogP | 2.16 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|