C25H27N5O4 — CID 177087689
3-[3-oxo-6-[(1R,2S)-2-(3-pyrimidin-5-ylazetidin-1-yl)cyclopentyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 177087689) has the molecular formula C25H27N5O4 and a molecular weight of 461.52 g/mol. Its IUPAC name is 3-[3-oxo-6-[(1R,2S)-2-(3-pyrimidin-5-ylazetidin-1-yl)cyclopentyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[(1R,2S)-2-(3-pyrimidin-5-ylazetidin-1-yl)cyclopentyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177087689 |
| Molecular Formula | C25H27N5O4 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 3-[3-oxo-6-[(1R,2S)-2-(3-pyrimidin-5-ylazetidin-1-yl)cyclopentyl]oxy-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(O[C@@H]4CCC[C@@H]4N4CC(c5cncnc5)C4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H27N5O4/c31-23-7-6-21(24(32)28-23)30-13-15-8-18(4-5-19(15)25(30)33)34-22-3-1-2-20(22)29-11-17(12-29)16-9-26-14-27-10-16/h4-5,8-10,14,17,20-22H,1-3,6-7,11-13H2,(H,28,31,32)/t20-,21?,22+/m0/s1 |
| InChIKey | BHUDZKGQBYGFCX-JAFNVKOHSA-N |
| XLogP | 1.64 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|